loading...| Preferred Name | alanine | |
| Synonyms |
2-Aminopropionic acid 2-Aminopropanoic acid ALA Alanin alanina A Alanine alanine 2-aminopropanoic acid |
|
| Definitions |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
|
| alternative label |
2-Aminopropionic acid 2-Aminopropanoic acid ALA Alanin alanina A Alanine alanine 2-aminopropanoic acid |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:635807 Wikipedia:Alanine Drug_Central:4306 PMID:22264337 Gmelin:2449 PMID:17439666 Reaxys:635807 KEGG:C01401 CAS:302-72-7 |
|
| definition |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
| formula |
C3H7NO2 |
|
| has characteristic | ||
| has exact synonym |
Alanine alanine 2-aminopropanoic acid |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:22277 CHEBI:13748 CHEBI:2539 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Aminopropionic acid 2-Aminopropanoic acid ALA Alanin alanina A |
|
| id |
CHEBI:16449 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
|
| inchikey |
QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
alanine |
|
| mass |
89.09322 |
|
| monoisotopicmass |
89.04768 |
|
| notation |
CHEBI:16449 |
|
| note |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
| preferred label |
alanine |
|
| prefLabel |
alanine |
|
| smiles |
CC(N)C(O)=O |
|
| subClassOf |