loading...| Preferred Name | propionate | |
| Synonyms |
73.029 metacetonate EtCO2 anion C3H5O2 ethylformate InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 CCC([O-])=O 73.07060 propanoic acid, ion(1-) ethanecarboxylate pseudoacetate XBDQKXXYIPTUBI-UHFFFAOYSA-M -1 CH3-CH2-COO(-) carboxylatoethane propanoate propanate methylacetate propionate |
|
| Definitions |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17272 |
|
| database_cross_reference |
KEGG:C00163 PMID:17951291 Gmelin:1820 UM-BBD_compID:c0277 CAS:72-03-7 Beilstein:3587503 PMID:18375549 PMID:2647392 |
|
| has exact synonym |
propionate propanoate |
|
| has role | ||
| has_alternative_id |
CHEBI:26290 CHEBI:14903 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
73.029 metacetonate EtCO2 anion C3H5O2 ethylformate InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 CCC([O-])=O 73.07060 propanoic acid, ion(1-) ethanecarboxylate pseudoacetate XBDQKXXYIPTUBI-UHFFFAOYSA-M -1 CH3-CH2-COO(-) carboxylatoethane propanoate propanate methylacetate |
|
| id |
CHEBI:17272 |
|
| in_subset | ||
| is conjugate base of | ||
| label |
propionate |
|
| notation |
CHEBI:17272 |
|
| prefLabel |
propionate |
|
| textual definition |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
| subClassOf |