loading...| Preferred Name | L-arginine | |
| Synonyms |
(S)-2-amino-5-guanidinopentanoic acid N[C@@H](CCCNC(N)=N)C(O)=O (S)-2-Amino-5-guanidinovaleric acid InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 174.20100 (2S)-2-amino-5-guanidinopentanoic acid L-(+)-arginine C6H14N4O2 Arg arginine L-Arg (2S)-2-amino-5-(carbamimidamido)pentanoic acid L-Arginin R 0 ODKSFYDXXFIFQN-BYPYZUCNSA-N 174.112 L-arginine L-Arginine |
|
| Definitions |
An L-alpha-amino acid that is the L-isomer of arginine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16467 |
|
| database_cross_reference |
PMID:22243793 PMID:19030957 KEGG:C00062 PMID:22428068 PMID:11300497 PMID:11898853 DrugBank:DB00125 PMID:16416365 Gmelin:83283 PMID:22179117 KNApSAcK:C00001340 Wikipedia:L-arginine PMID:17439666 PMID:22361732 CAS:74-79-3 ECMDB:ECMDB00517 PMID:15465805 PMID:15016745 PMID:22652429 PMID:11139824 PMID:22667467 PMID:22251130 PMID:21814794 PMID:16056256 PMID:22439203 KEGG:D02982 HMDB:HMDB00517 PMID:22619480 PMID:22553931 PMID:22709481 PMID:22425811 PDBeChem:GND YMDB:YMDB00592 Beilstein:1725413 PMID:21600268 PMID:17168727 Drug_Central:1549 PDBeChem:ARG PMID:22626826 PMID:12812828 MetaCyc:ARG Reaxys:1725413 PMID:8070089 PMID:10848923 |
|
| has exact synonym |
L-arginine L-Arginine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 |
|
| has_alternative_id |
CHEBI:21235 CHEBI:42927 CHEBI:6185 CHEBI:13077 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(S)-2-amino-5-guanidinopentanoic acid N[C@@H](CCCNC(N)=N)C(O)=O (S)-2-Amino-5-guanidinovaleric acid InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 174.20100 (2S)-2-amino-5-guanidinopentanoic acid L-(+)-arginine C6H14N4O2 Arg arginine L-Arg (2S)-2-amino-5-(carbamimidamido)pentanoic acid L-Arginin R 0 ODKSFYDXXFIFQN-BYPYZUCNSA-N 174.112 |
|
| id |
CHEBI:16467 |
|
| in_subset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| label |
L-arginine |
|
| notation |
CHEBI:16467 |
|
| prefLabel |
L-arginine |
|
| textual definition |
An L-alpha-amino acid that is the L-isomer of arginine. |
|
| subClassOf |