loading...| Preferred Name | arginine | |
| Synonyms |
NC(CCCNC(N)=N)C(O)=O 2-amino-5-(carbamimidamido)pentanoic acid Arginin 174.20112 C6H14N4O2 InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) ODKSFYDXXFIFQN-UHFFFAOYSA-N 2-amino-5-guanidinopentanoic acid 0 Harg 174.112 2-Amino-5-guanidinovaleric acid arginine Arginine |
|
| Definitions |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29016 |
|
| database_cross_reference |
colombos:ARGININE Beilstein:1725411 KEGG:C02385 Reaxys:1725411 CAS:7200-25-1 Wikipedia:L-Arginine PMID:10848923 |
|
| formula |
C6H14N4O2 |
|
| has exact synonym |
arginine Arginine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:2643 CHEBI:22616 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
NC(CCCNC(N)=N)C(O)=O 2-amino-5-(carbamimidamido)pentanoic acid Arginin 174.20112 C6H14N4O2 InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) ODKSFYDXXFIFQN-UHFFFAOYSA-N 2-amino-5-guanidinopentanoic acid 0 Harg 174.112 2-Amino-5-guanidinovaleric acid |
|
| id |
CHEBI:29016 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
|
| inchikey |
ODKSFYDXXFIFQN-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
arginine |
|
| mass |
174.20112 |
|
| monoisotopicmass |
174.112 |
|
| notation |
CHEBI:29016 |
|
| prefLabel |
arginine |
|
| smiles |
NC(CCCNC(N)=N)C(O)=O |
|
| textual definition |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
|
| subClassOf |