loading...| Preferred Name | pyruvate | |
| Synonyms |
LCTONWCANYUPML-UHFFFAOYSA-M CC(=O)C([O-])=O 87.05412 InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 -1 2-oxopropanoate 87.008 C3H3O3 2-oxopropanoic acid, ion(1-) pyruvate |
|
| Definitions |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15361 |
|
| database_cross_reference |
colombos:PYRUVATE PMID:22006570 PMID:21823181 PMID:21854850 KEGG:C00022 Gmelin:2502 PMID:22451307 UM-BBD_compID:c0159 PMID:22458763 Beilstein:3587721 CAS:57-60-3 PMID:22016370 PMID:22215378 Reaxys:3587721 PMID:17190852 PMID:22311625 PMID:21603897 |
|
| has exact synonym |
pyruvate 2-oxopropanoate |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:26462 CHEBI:14987 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
LCTONWCANYUPML-UHFFFAOYSA-M CC(=O)C([O-])=O 87.05412 InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 -1 2-oxopropanoate 87.008 C3H3O3 2-oxopropanoic acid, ion(1-) |
|
| id |
CHEBI:15361 |
|
| in_subset | ||
| is conjugate base of | ||
| label |
pyruvate |
|
| notation |
CHEBI:15361 |
|
| prefLabel |
pyruvate |
|
| textual definition |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
| subClassOf |