loading...| Preferred Name | salicylic acid | |
| Synonyms |
o-carboxyphenol 2-HYDROXYBENZOIC ACID o-hydroxybenzoic acid 2-carboxyphenol o-Hydroxybenzoic acid Salicylic acid 2-hydroxybenzoic acid |
|
| Definitions |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16914 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:3418 KEGG:C00805 PMID:19400653 PMID:1650428 PMID:22770225 HMDB:HMDB0001895 PMID:29079364 CAS:69-72-7 Wikipedia:Salicylic_Acid PMID:3425858 Reaxys:774890 Drug_Central:2416 PMID:11016405 PMID:12865403 Beilstein:774890 MetaCyc:CPD-110 DrugBank:DB00936 KNApSAcK:C00000206 LINCS:LSM-4763 PMID:32807953 PMID:19816125 KEGG:D00097 PDBeChem:SAL |
|
| definition |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| formula |
C7H6O3 |
|
| has exact synonym |
Salicylic acid 2-hydroxybenzoic acid |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_35441 http://purl.obolibrary.org/obo/CHEBI_37848 http://purl.obolibrary.org/obo/CHEBI_50176 http://purl.obolibrary.org/obo/CHEBI_73181 |
|
| has_alternative_id |
CHEBI:45521 CHEBI:26597 CHEBI:9006 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
o-carboxyphenol 2-HYDROXYBENZOIC ACID o-hydroxybenzoic acid 2-carboxyphenol o-Hydroxybenzoic acid |
|
| id |
CHEBI:16914 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
|
| inchikey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
salicylic acid |
|
| mass |
138.12070 |
|
| monoisotopicmass |
138.03169 |
|
| notation |
CHEBI:16914 |
|
| prefLabel |
salicylic acid |
|
| smiles |
OC(=O)c1ccccc1O |
|
| subClassOf |