loading...| Preferred Name | bilirubin | |
| Synonyms |
|
|
| Definitions |
A member of the class of biladienes that is a linear tetrapyrrole with the dipyrrole units being of both exovinyl and endovinyl type. A product of heme degradation, it is produced in the reticuloendothelial system by the reduction of biliverdin and transported to the liver as a complex with serum albumin. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16990 |
|
| database cross reference |
Wikipedia:Bilirubin |
|
| definition |
A member of the class of biladienes that is a linear tetrapyrrole with the dipyrrole units being of both exovinyl and endovinyl type. A product of heme degradation, it is produced in the reticuloendothelial system by the reduction of biliverdin and transported to the liver as a complex with serum albumin. |
|
| formula |
C33H36N4O6 |
|
| label |
bilirubin |
|
| prefixIRI |
CHEBI:16990 |
|
| prefLabel |
bilirubin |
|
| smiles |
CC1=C(C=C)\C(NC1=O)=C\c1[nH]c(Cc2[nH]c(\C=C3NC(=O)C(C=C)=C/3C)c(C)c2CCC(O)=O)c(CCC(O)=O)c1C |
|
| subClassOf |