Link to this page
Human Interaction Network Ontology
Last uploaded:
June 27, 2014
Jump to:
| Preferred Name | benzoic acid | |
| Synonyms |
Phenylformic acid E210 InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) Benzoesaeure acide benzoique C7H6O2 Dracylic acid Benzenemethanoic acid InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzeneformic acid Phenylcarboxylic acid OC(=O)c1ccccc1 Benzenecarboxylic acid BENZOIC ACID benzoic acid Benzoic acid |
|
| Definitions |
A compound comprising a benzene ring core carrying a carboxylic acid substituent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30746 |
|
| database_cross_reference |
KEGG DRUG:D00038 HMDB:HMDB01870 Reaxys:636131 Beilstein:636131 ChemIDplus:65-85-0 MetaCyc:BENZOATE CiteXplore:17439666 Gmelin:2946 PDBeChem:BEZ NIST Chemistry WebBook:65-85-0 KEGG COMPOUND:C00180 Wikipedia:Benzoic_Acid KEGG COMPOUND:65-85-0 DrugBank:DB03793
|
|
| definition |
A compound comprising a benzene ring core carrying a carboxylic acid substituent.
|
|
| has_alternative_id |
CHEBI:3029 CHEBI:22722 CHEBI:41051
|
|
| has_exact_synonym |
BENZOIC ACID benzoic acid Benzoic acid
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
Phenylformic acid E210 InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) Benzoesaeure acide benzoique C7H6O2 Dracylic acid Benzenemethanoic acid InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzeneformic acid Phenylcarboxylic acid OC(=O)c1ccccc1 Benzenecarboxylic acid
|
|
| id |
CHEBI:30746
|
|
| imported from | ||
| label |
benzoic acid
|
|
| notation |
CHEBI:30746
|
|
| prefixIRI |
CHEBI:30746
|
|
| prefLabel |
benzoic acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping