loading...| Preferred Name | tyrosine | |
| Synonyms |
Y 2-amino-3-(4-hydroxyphenyl)propanoic acid NC(Cc1ccc(O)cc1)C(O)=O 3-(p-Hydroxyphenyl)alanine C9H11NO3 InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) 2-Amino-3-(p-hydroxyphenyl)propionic acid Tyr Tyrosin tirosina InChIKey=OUYCCCASQSFEME-UHFFFAOYSA-N Tyrosine tyrosine |
|
| Definitions |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18186 |
|
| database_cross_reference |
KEGG COMPOUND:C01536 Gmelin:27744 ChemIDplus:55520-40-6 Reaxys:515881 Beilstein:515881 CiteXplore:17190852 |
|
| definition |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
|
| has_alternative_id |
CHEBI:27176 CHEBI:9800 CHEBI:15277 |
|
| has_exact_synonym |
Tyrosine tyrosine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Y 2-amino-3-(4-hydroxyphenyl)propanoic acid NC(Cc1ccc(O)cc1)C(O)=O 3-(p-Hydroxyphenyl)alanine C9H11NO3 InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) 2-Amino-3-(p-hydroxyphenyl)propionic acid Tyr Tyrosin tirosina InChIKey=OUYCCCASQSFEME-UHFFFAOYSA-N |
|
| id |
CHEBI:18186 |
|
| imported from | ||
| label |
tyrosine |
|
| notation |
CHEBI:18186 |
|
| prefLabel |
tyrosine |
|
| subClassOf |