loading...| Preferred Name | adenine | |
| Synonyms |
Nc1ncnc2[nH]cnc12 C5H5N5 InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) Ade A 6-Aminopurine Adenin InChIKey=GFFGJBXGBJISGV-UHFFFAOYSA-N adenine 9H-purin-6-amine Adenine ADENINE |
|
| Definitions |
The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16708 |
|
| database_cross_reference |
PDBeChem:ADE Beilstein:608603 KEGG COMPOUND:C00147 KEGG COMPOUND:73-24-5 CiteXplore:17439666 ChemIDplus:73-24-5 Gmelin:3903 MetaCyc:ADENINE Wikipedia:Adenine CiteXplore:8070089 DrugBank:DB00173 HMDB:HMDB00034 KEGG DRUG:D00034 NIST Chemistry WebBook:73-24-5 Reaxys:608603 |
|
| definition |
The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. |
|
| has_alternative_id |
CHEBI:2470 CHEBI:40579 CHEBI:22236 CHEBI:13733 |
|
| has_exact_synonym |
adenine 9H-purin-6-amine Adenine ADENINE |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Nc1ncnc2[nH]cnc12 C5H5N5 InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) Ade A 6-Aminopurine Adenin InChIKey=GFFGJBXGBJISGV-UHFFFAOYSA-N |
|
| id |
CHEBI:16708 |
|
| imported from | ||
| label |
adenine |
|
| notation |
CHEBI:16708 |
|
| prefixIRI |
CHEBI:16708 |
|
| prefLabel |
adenine |
|
| subClassOf |