loading...| Preferred Name | salicylic acid | |
| Synonyms |
|
|
| Definitions |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16914 |
|
| alternative term |
2-hydroxybenzoic acid |
|
| BiomarkerOf |
http://purl.obolibrary.org/obo/FOODON_03306632 http://purl.obolibrary.org/obo/FOODON_00001057 http://purl.obolibrary.org/obo/FOODON_00001261 http://purl.obolibrary.org/obo/FOODON_03301826 http://purl.obolibrary.org/obo/FOODON_03310272 http://purl.obolibrary.org/obo/FOODON_00001139 http://purl.obolibrary.org/obo/FOODON_00001138 http://purl.obolibrary.org/obo/FOODON_00001264 |
|
| ChemSpider |
14879126 | 16373679 | 331 |
|
| FOBI |
FOBI:030318 |
|
| HMDB |
HMDB01895 |
|
| id |
CHEBI:16914 |
|
| imported from | ||
| InChICode |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
|
| InChIKey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
|
| KEGG |
C00805 | D00097 |
|
| label |
salicylic acid |
|
| notation |
CHEBI:16914 |
|
| prefixIRI |
CHEBI:16914 |
|
| prefLabel |
salicylic acid |
|
| PubChemCID |
338 |
|
| textual definition |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| subClassOf |