loading...| Preferred Name | primidone | |
| Synonyms |
2-deoxyphenobarbital 5-Phenyl-5-ethyl-Hexahydropyrimidine-4,6-dione primidona primidone primidonum 5-ethyl-5-phenyldihydropyrimidine-4,6(1H,5H)-dione |
|
| Definitions |
A pyrimidone that is dihydropyrimidine-4,6(1H,5H)-dione substituted by an ethyl and a phenyl group at position 5. It is used as an anticonvulsant for treatment of various types of seizures. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8412 |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| charge |
0 |
|
| formula |
C12H14N2O2 |
|
| has exact synonym |
5-ethyl-5-phenyldihydropyrimidine-4,6(1H,5H)-dione |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
2-deoxyphenobarbital 5-Phenyl-5-ethyl-Hexahydropyrimidine-4,6-dione primidona primidone primidonum |
|
| id |
CHEBI:8412 |
|
| inchi |
InChI=1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) |
|
| inchikey |
DQMZLTXERSFNPB-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
primidone |
|
| mass |
218.25180 |
|
| monoisotopicmass |
218.10553 |
|
| notation |
CHEBI:8412 |
|
| prefLabel |
primidone |
|
| smiles |
CCC1(C(=O)NCNC1=O)c1ccccc1 |
|
| textual definition |
A pyrimidone that is dihydropyrimidine-4,6(1H,5H)-dione substituted by an ethyl and a phenyl group at position 5. It is used as an anticonvulsant for treatment of various types of seizures. |
|
| xRef |
KEGG:D00474 HMDB:HMDB0014932 PMID:24712318 CAS:125-33-7 LINCS:LSM-2700 PMID:24812533 PMID:17253477 DrugBank:DB00794 PMID:10716065 Drug_Central:2267 Reaxys:218034 KEGG:C07371 Wikipedia:Primidone |
|
| subClassOf |