loading...| Preferred Name | moclobemide | |
| Synonyms |
moclobemidum moclobemida moclobemide 4-chloro-N-[2-(morpholin-4-yl)ethyl]benzamide |
|
| Definitions |
A member of the class of benzamides that is benzamide substituted by a chloro group at position 4 and a 2-(morpholin-4-yl)ethyl group at the nitrogen atom. It acts as a reversible monoamine oxidase inhibitor and is used in the treatment of depression. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_83531 |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| charge |
0 |
|
| formula |
C13H17ClN2O2 |
|
| has exact synonym |
4-chloro-N-[2-(morpholin-4-yl)ethyl]benzamide |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
moclobemidum moclobemida moclobemide |
|
| id |
CHEBI:83531 |
|
| inchi |
InChI=1S/C13H17ClN2O2/c14-12-3-1-11(2-4-12)13(17)15-5-6-16-7-9-18-10-8-16/h1-4H,5-10H2,(H,15,17) |
|
| inchikey |
YHXISWVBGDMDLQ-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
moclobemide |
|
| mass |
268.73900 |
|
| monoisotopicmass |
268.09786 |
|
| notation |
CHEBI:83531 |
|
| prefLabel |
moclobemide |
|
| smiles |
Clc1ccc(cc1)C(=O)NCCN1CCOCC1 |
|
| textual definition |
A member of the class of benzamides that is benzamide substituted by a chloro group at position 4 and a 2-(morpholin-4-yl)ethyl group at the nitrogen atom. It acts as a reversible monoamine oxidase inhibitor and is used in the treatment of depression. |
|
| xRef |
Drug_Central:1825 PMID:23616181 LINCS:LSM-5247 PMID:25335956 HMDB:HMDB0015302 PMID:24863864 CAS:71320-77-9 PMID:24859491 DrugBank:DB01171 Reaxys:530974 KEGG:D02561 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 |