Jump to:
loading...| Preferred Name | glycolate | |
| Synonyms |
hydroxyacetate glycolate |
|
| Definitions |
A hydroxy monocarboxylic acid anion that is acetate where the methyl group has been hydroxylated. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29805 |
|
| bearer of | ||
| charge |
-1 |
|
| formula |
C2H3O3 |
|
| has exact synonym |
hydroxyacetate glycolate |
|
| has functional parent | ||
| has role | ||
| hasAlternativeId |
CHEBI:14348 CHEBI:24388 |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:29805 |
|
| inchi |
InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1 |
|
| inchikey |
AEMRFAOFKBGASW-UHFFFAOYSA-M |
|
| inSubset | ||
| is conjugate base of | ||
| label |
glycolate |
|
| mass |
75.04342 |
|
| monoisotopicmass |
75.00877 |
|
| notation |
CHEBI:29805 |
|
| prefLabel |
glycolate |
|
| smiles |
OCC([O-])=O |
|
| textual definition |
A hydroxy monocarboxylic acid anion that is acetate where the methyl group has been hydroxylated. |
|
| xRef |
PMID:22446032 KEGG:C00160 PMID:22093610 UM-BBD_compID:c0008 CAS:666-14-8 PMID:22394389 PMID:22268146 DrugBank:DB03085 PMID:22327578 PMID:17190852 PMID:22207577 Reaxys:3903689 MetaCyc:GLYCOLLATE |
|
| subClassOf |
Create mapping