loading...| Preferred Name | lycopene | |
| Synonyms |
(6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene all-trans-lycopene psi,psi-carotene LYCOPENE Lycopene |
|
| Definitions |
An acyclic carotene commonly obtained from tomatoes and other red fruits. LanguaL term definition: Food additive; technological purpose(s): colour. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15948 |
|
| comment |
LanguaL term definition: Food additive; technological purpose(s): colour. |
|
| charge |
0 |
|
| formula |
C40H56 |
|
| has exact synonym |
psi,psi-carotene LYCOPENE Lycopene |
|
| hasAlternativeId |
CHEBI:14541 CHEBI:26367 CHEBI:43789 CHEBI:6596 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
(6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene all-trans-lycopene |
|
| hasSynonym |
lycopenes |
|
| IAO_0000118 |
lycopene |
|
| IAO_0000412 |
http://purl.obolibrary.org/obo/chebi.owl |
|
| id |
CHEBI:15948 |
|
| inchi |
InChI=1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+ |
|
| inchikey |
OAIJSZIZWZSQBC-GYZMGTAESA-N |
|
| inSubset | ||
| label |
lycopene |
|
| mass |
536.87264 |
|
| monoisotopicmass |
536.43820 |
|
| notation |
CHEBI:15948 |
|
| prefLabel |
lycopene |
|
| smiles |
CC(C)=CCC\C(C)=C\C=C\C(C)=C\C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C=C(/C)CCC=C(C)C |
|
| textual definition |
An acyclic carotene commonly obtained from tomatoes and other red fruits. |
|
| xRef |
LIPID_MAPS_instance:LMPR01070257 MetaCyc:CPD1F-114 PMID:16194683 PDBeChem:LYC PMID:12792623 PMID:15830922 PMID:1550343 Europe::160d PMID:15065899 PMID:24397737 KEGG:C05432 HMDB:HMDB0003000 PMID:12910307 Reaxys:1730097 PMID:12726756 PMID:10620348 PMID:15341191 Beilstein:1730097 PMID:12239422 PMID:13129444 PMID:10493308 PMID:7616301 Drug_Central:4617 PMID:10443333 CAS:502-65-8 http://www.langual.org/langual_thesaurus.asp?termid=B3134 Wikipedia:Lycopene Codex::160e PMID:10720168 COMe:MOL000048 PMID:11117277 PMID:11137891 KNApSAcK:C00000911 PMID:16549453 PMID:10837319 PMID:15054415 PMID:9100211 |
|
| subClassOf |