loading...| Preferred Name |
dexmethylphenidate |
|
| Synonyms |
dexmetilfenidato dexmethylphenidatum methyl (R)-phenyl[(R)-piperidin-2-yl]acetate dexmethylphenidate d-threo-methylphenidate (+)-threo-methylphenidate methyl (2R)-phenyl[(2R)-piperidin-2-yl]acetate |
|
| Definitions |
A methyl phenyl(piperidin-2-yl)acetate in which both stereocentres have R configuration. It is the active enantiomer in the racemic drug methylphenidate. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_51860 |
|
| alternative label |
dexmetilfenidato dexmethylphenidatum methyl (R)-phenyl[(R)-piperidin-2-yl]acetate dexmethylphenidate d-threo-methylphenidate (+)-threo-methylphenidate methyl (2R)-phenyl[(2R)-piperidin-2-yl]acetate |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Dexmethylphenidate Beilstein:6116309 CAS:40431-64-9 Drug_Central:836 |
|
| definition |
A methyl phenyl(piperidin-2-yl)acetate in which both stereocentres have R configuration. It is the active enantiomer in the racemic drug methylphenidate. |
|
| formula |
C14H19NO2 |
|
| has role | ||
| has_exact_synonym |
methyl (2R)-phenyl[(2R)-piperidin-2-yl]acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dexmetilfenidato dexmethylphenidatum methyl (R)-phenyl[(R)-piperidin-2-yl]acetate dexmethylphenidate d-threo-methylphenidate (+)-threo-methylphenidate |
|
| has_RxCUI |
352372 |
|
| id |
CHEBI:51860 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3/t12-,13-/m1/s1 |
|
| inchikey |
DUGOZIWVEXMGBE-CHWSQXEVSA-N |
|
| is enantiomer of | ||
| label |
dexmethylphenidate |
|
| mass |
233.30620 |
|
| monoisotopicmass |
233.14158 |
|
| notation |
CHEBI:51860 |
|
| prefLabel |
dexmethylphenidate |
|
| smiles |
COC(=O)[C@@H]([C@H]1CCCCN1)c1ccccc1 |
|
| subClassOf |