loading...| Preferred Name | paracetamol | |
| Synonyms |
p-acetaminophenol N-acetyl-p-aminophenol 4-acetamidophenol acetaminofen p-hydroxyacetanilide Acetaminofen paracetamol p-Acetylaminophenol acetaminophene paracetamolum Acetaminophen p-acetamidophenol p-hydroxyphenolacetamide 4-(Acetylamino)phenol 4'-hydroxyacetanilide APAP Acenol Panadol Tylenol N-(4-hydroxyphenyl)acetamide Paracetamol |
|
| Definitions |
A member of the class of phenols that is 4-aminophenol in which one of the hydrogens attached to the amino group has been replaced by an acetyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_46195 |
|
| alternative label |
p-acetaminophenol N-acetyl-p-aminophenol 4-acetamidophenol acetaminofen p-hydroxyacetanilide Acetaminofen paracetamol p-Acetylaminophenol acetaminophene paracetamolum Acetaminophen p-acetamidophenol p-hydroxyphenolacetamide 4-(Acetylamino)phenol 4'-hydroxyacetanilide APAP Acenol Panadol Tylenol N-(4-hydroxyphenyl)acetamide Paracetamol |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18953082 KEGG:D00217 CAS:103-90-2 Wikipedia:Acetaminophen PMID:25128677 PMID:21108564 DrugBank:DB00316 KEGG:C06804 PMID:11304127 PMID:7602118 MetaCyc:CPD-7669 PMID:22114686 Reaxys:2208089 LINCS:LSM-5533 HMDB:HMDB0001859 Chemspider:1906 PMID:25962350 Drug_Central:52 PMID:28734939 PMID:22770225 PDBeChem:TYL Beilstein:2208089 PMID:27320817 PMID:29398597 PMID:11084378 PMID:16716555 |
|
| definition |
A member of the class of phenols that is 4-aminophenol in which one of the hydrogens attached to the amino group has been replaced by an acetyl group. |
|
| formula |
C8H9NO2 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_85234 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_50908 http://purl.obolibrary.org/obo/CHEBI_173085 http://purl.obolibrary.org/obo/CHEBI_73263 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_78298 |
|
| has_alternative_id |
CHEBI:46191 CHEBI:2386 |
|
| has_exact_synonym |
N-(4-hydroxyphenyl)acetamide Paracetamol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
p-acetaminophenol N-acetyl-p-aminophenol 4-acetamidophenol acetaminofen p-hydroxyacetanilide Acetaminofen paracetamol p-Acetylaminophenol acetaminophene paracetamolum Acetaminophen p-acetamidophenol p-hydroxyphenolacetamide 4-(Acetylamino)phenol 4'-hydroxyacetanilide APAP Acenol Panadol Tylenol |
|
| has_RxCUI |
161 |
|
| id |
CHEBI:46195 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) |
|
| inchikey |
RZVAJINKPMORJF-UHFFFAOYSA-N |
|
| label |
paracetamol |
|
| mass |
151.165 |
|
| monoisotopicmass |
151.06333 |
|
| notation |
CHEBI:46195 |
|
| prefLabel |
paracetamol |
|
| smiles |
CC(=O)NC1=CC=C(O)C=C1 |
|
| subClassOf |