loading...| Preferred Name | retinoic acid | |
| Synonyms |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
|
| Definitions |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraenoic acid substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_26536 |
|
| alternative label |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24506204 LINCS:LSM-2135 |
|
| definition |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraenoic acid substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
|
| formula |
C20H28O2 |
|
| has role | ||
| has_exact_synonym |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:26536 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22) |
|
| inchikey |
SHGAZHPCJJPHSC-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
retinoic acid |
|
| mass |
300.43512 |
|
| monoisotopicmass |
300.20893 |
|
| notation |
CHEBI:26536 |
|
| prefLabel |
retinoic acid |
|
| smiles |
CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(O)=O |
|
| subClassOf |