Preferred Name |
Glycerin |
|
Synonyms |
glycyl alcohol 1,2,3-Propanetriol Propanetriol Trihydroxypropane 1,2,3-Trihydroxypropane Glycerin Glyceritol Glyzerin Gro Oelsuess glycerine glycerol glycerolum propane-1,2,3-triol GLYCEROL Glycerol |
|
Definitions |
A triol with a structure of propane substituted at positions 1, 2 and 3 by hydroxy groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17754 |
|
alternative label |
glycyl alcohol 1,2,3-Propanetriol Propanetriol Trihydroxypropane 1,2,3-Trihydroxypropane Glycerin Glyceritol Glyzerin Gro Oelsuess glycerine glycerol glycerolum propane-1,2,3-triol GLYCEROL Glycerol |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Glycerol UM-BBD_compID:c0066 FooDB:FDB000756 PMID:14563847 PMID:7392035 PMID:16651733 Chemspider:733 PMID:15342117 PMID:558160 PMID:11302662 PMID:12687625 PMID:15983192 Beilstein:635685 PMID:16258193 PMID:19184438 PMID:16475911 PMID:19956799 HMDB:HMDB0000131 PMID:16349488 PMID:12713573 DrugBank:DB04077 PMID:12689633 ECMDB:ECMDB00131 PMID:16901854 PMID:15026783 Drug_Central:1316 PMID:6299616 PMID:12672239 PMID:24643482 PMID:15786693 YMDB:YMDB00283 PMID:17439666 PMID:11994365 Reaxys:635685 PMID:16319039 PMID:19460032 PMID:17979222 KEGG:C00116 CAS:56-81-5 PMID:23562176 PDBeChem:GOL PMID:17336832 PMID:23747440 PMID:19795216 PMID:16244855 PMID:16664750 KEGG:D00028 PMID:14559393 PMID:7031247 PMID:22705534 Gmelin:26279 PMID:11958517 KNApSAcK:C00001163 PMID:25108762 LINCS:LSM-37180 PMID:24835191 PMID:19548674 PMID:19231894 MetaCyc:GLYCEROL PDB:2AJS PDB:2D03 PPDB:1317 |
|
definition |
A triol with a structure of propane substituted at positions 1, 2 and 3 by hydroxy groups. |
|
formula |
C3H8O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_46787 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_25728 http://purl.obolibrary.org/obo/CHEBI_27780 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
has_alternative_id |
CHEBI:24351 CHEBI:131422 CHEBI:14334 CHEBI:42998 CHEBI:5448 |
|
has_exact_synonym |
propane-1,2,3-triol GLYCEROL Glycerol glycerol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
glycyl alcohol 1,2,3-Propanetriol Propanetriol Trihydroxypropane 1,2,3-Trihydroxypropane Glycerin Glyceritol Glyzerin Gro Oelsuess glycerine glycerol glycerolum |
|
has_RxCUI |
4910 |
|
id |
CHEBI:17754 |
|
in_subset | ||
inchi |
InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
|
inchikey |
PEDCQBHIVMGVHV-UHFFFAOYSA-N |
|
label |
Glycerin glycerol |
|
mass |
92.09382 |
|
monoisotopicmass |
92.04734 |
|
notation |
CHEBI:17754 |
|
prefLabel |
Glycerin |
|
smiles |
OCC(O)CO |
|
subClassOf |