loading...| Preferred Name | propionate | |
| Synonyms |
ethylformate propanoic acid, ion(1-) pseudoacetate metacetonate CH3-CH2-COO(-) methylacetate EtCO2 anion ethanecarboxylate carboxylatoethane propanate propanoate propionate |
|
| Definitions |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17272 |
|
| alternative label |
ethylformate propanoic acid, ion(1-) pseudoacetate metacetonate CH3-CH2-COO(-) methylacetate EtCO2 anion ethanecarboxylate carboxylatoethane propanate propanoate propionate |
|
| charge |
-1 |
|
| database_cross_reference |
UM-BBD_compID:c0277 KEGG:C00163 PMID:2647392 CAS:72-03-7 PMID:17951291 Gmelin:1820 PMID:18375549 Beilstein:3587503 |
|
| definition |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
| formula |
C3H5O2 |
|
| has role | ||
| has_alternative_id |
CHEBI:14903 CHEBI:26290 |
|
| has_exact_synonym |
propanoate propionate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ethylformate propanoic acid, ion(1-) pseudoacetate metacetonate CH3-CH2-COO(-) methylacetate EtCO2 anion ethanecarboxylate carboxylatoethane propanate propanoate |
|
| id |
CHEBI:17272 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 |
|
| inchikey |
XBDQKXXYIPTUBI-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
propionate |
|
| mass |
73.07060 |
|
| monoisotopicmass |
73.02950 |
|
| notation |
CHEBI:17272 |
|
| prefLabel |
propionate |
|
| smiles |
CCC([O-])=O |
|
| subClassOf |