loading...| Preferred Name | progesterone | |
| Synonyms |
Gelbkoerperhormon Delta(4)-pregnene-3,20-dione luteohormone (S)-Progesterone 17alpha-progesterone (S)-4-Pregnene-3,20-dione (S)-Pregn-4-en-3,20-dione 4-Pregnene-3,20-dione Progesteron corpus luteum hormone Agolutin Akrolutin Crinone progesterone PROGESTERONE pregn-4-ene-3,20-dione Progesterone |
|
| Definitions |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17026 |
|
| alternative label |
Gelbkoerperhormon Delta(4)-pregnene-3,20-dione luteohormone (S)-Progesterone 17alpha-progesterone (S)-4-Pregnene-3,20-dione (S)-Pregn-4-en-3,20-dione 4-Pregnene-3,20-dione Progesteron corpus luteum hormone Agolutin Akrolutin Crinone progesterone PROGESTERONE pregn-4-ene-3,20-dione Progesterone |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C00410 CAS:57-83-0 PMID:9506942 Wikipedia:Progesterone Beilstein:1915950 Gmelin:708590 Drug_Central:2279 DrugBank:DB00396 MetaCyc:PROGESTERONE Reaxys:1915950 PDBeChem:STR PMID:10438974 KEGG:D00066 HMDB:HMDB0001830 |
|
| definition |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
| formula |
C21H30O2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_59826 http://purl.obolibrary.org/obo/CHEBI_70709 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:14896 CHEBI:45786 CHEBI:26269 CHEBI:18798 CHEBI:439 CHEBI:8453 |
|
| has_exact_synonym |
progesterone PROGESTERONE pregn-4-ene-3,20-dione Progesterone |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Gelbkoerperhormon Delta(4)-pregnene-3,20-dione luteohormone (S)-Progesterone 17alpha-progesterone (S)-4-Pregnene-3,20-dione (S)-Pregn-4-en-3,20-dione 4-Pregnene-3,20-dione Progesteron corpus luteum hormone Agolutin Akrolutin Crinone |
|
| has_RxCUI |
8727 |
|
| id |
CHEBI:17026 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 |
|
| inchikey |
RJKFOVLPORLFTN-LEKSSAKUSA-N |
|
| is_bearer_of | ||
| label |
progesterone |
|
| mass |
314.46170 |
|
| monoisotopicmass |
314.22458 |
|
| notation |
CHEBI:17026 |
|
| prefLabel |
progesterone |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 |