loading...| Preferred Name | cholesterol | |
| Synonyms |
(1R,2S,5R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-5-ol C27H46O |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB04540 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_1440 |
|
| CASRN |
57-88-5 |
|
| Definition |
The principal sterol of all higher animals, distributed in body tissues, especially the brain and spinal cord, and in animal fats and oils. [PubChem] |
|
| InChI |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21-,22+,23-,24+,25-,26-,27-/m1/s1 |
|
| InChIKey |
InChIKey=HVYWMOMLDIMFJA-MFYRMPRMSA-N |
|
| inhibits | ||
| is substrate of | ||
| is transported by | ||
| label |
cholesterol |
|
| prefixIRI |
obo2:dinto_DB04540 |
|
| prefLabel |
cholesterol |
|
| related with | ||
| SMILES |
CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](O)CC[C@@]4(C)[C@@H]3CC[C@]12C |
|
| Synonym |
(1R,2S,5R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-5-ol C27H46O |
|
| xref |
BindingDB:20192 PubChem Compound:46937002 PDB:CLR ChemSpider:298 ChEBI:16113 PubChem Substance:46508234 |
|
| subClassOf |