loading...| Preferred Name |
mitomycin |
|
| Synonyms |
[(4S,6S,7R,8S)-11-amino-7-methoxy-12-methyl-10,13-dioxo-2,5-diazatetracyclo[7.4.0.0^{2,7}.0^{4,6}]trideca-1(9),11-dien-8-yl]methyl carbamate C15H18N4O5 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00305 |
|
| AHFScode |
10:00.00 |
|
| ATCCode |
L01DC03 |
|
| blocks | ||
| CASRN |
50-07-7 |
|
| DBBrand |
mitomycyna c [polish] mitomycin c mitosol mitomycin (tn) mitomycinum c ametycine mytozytrex mitocin-c mutamycin mito-c mit-c mitomycin-c mitomycinum ametycin mytomycin muamycin mitozytrex |
|
| DBSynonym |
mmc 7-amino-9-methoxymitosane mitamycin |
|
| Definition |
An antineoplastic antibiotic produced by Streptomyces caespitosus. It is one of the bi- or tri-functional alkylating agents causing cross-linking of DNA and inhibition of DNA synthesis. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23-2)13-7(18-13)3-19(15)10(8)11(5)20/h6-7,13,18H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7+,13+,15-/m1/s1 |
|
| InChIKey |
InChIKey=NWIBSHFKIJFRCO-WUDYKRTCSA-N |
|
| inhibits | ||
| is metabolised by | ||
| label |
mitomycin |
|
| may interact with |
http://purl.obolibrary.org/obo/dinto_DB00541 http://purl.obolibrary.org/obo/CHEBI_36373 |
|
| prefixIRI |
obo2:dinto_DB00305 |
|
| prefLabel |
mitomycin |
|
| related with | ||
| SMILES |
CO[C@]12[C@H]3N[C@H]3CN1C1=C([C@H]2COC(N)=O)C(=O)C(N)=C(C)C1=O |
|
| Synonym |
[(4S,6S,7R,8S)-11-amino-7-methoxy-12-methyl-10,13-dioxo-2,5-diazatetracyclo[7.4.0.0^{2,7}.0^{4,6}]trideca-1(9),11-dien-8-yl]methyl carbamate C15H18N4O5 |
|
| xref |
National Drug Code Directory:55390-451-01 PubChem Substance:46508353 Drugs.com:http://www.drugs.com/cdi/mitomycin.html RxList:http://www.rxlist.com/cgi/generic3/mitomycin.htm ChemSpider:5544 Wikipedia:http://en.wikipedia.org/wiki/Mitomycin PharmGKB:PA450524 Drugs Product Database (DPD):2230729 ChEBI:27504 PubChem Compound:5746 |
|
| subClassOf |