Preferred Name | cortisol | |
Synonyms |
Kendall's compound F Reichstein's substance M hydrocortisonum 11beta,17alpha,21-trihydroxy-4-pregnene-3,20-dione (11beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione 4-pregnen-11beta,17alpha,21-triol-3,20-dione hydrocortisone 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione 11beta-hydrocortisone hidrocortisona 17-hydroxycorticosterone Hydrocortisone 11beta,17,21-trihydroxypregn-4-ene-3,20-dione Cortisol cortisol |
|
Definitions |
A 17alpha-hydroxy-C21-steroid that is pregn-4-ene substituted by oxo groups at positions 3 and 20 and hydroxy groups at positions 11, 17 and 21. Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the "stress hormone" as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17650 |
|
alternative label |
Kendall's compound F Reichstein's substance M hydrocortisonum 11beta,17alpha,21-trihydroxy-4-pregnene-3,20-dione (11beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione 4-pregnen-11beta,17alpha,21-triol-3,20-dione hydrocortisone 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione 11beta-hydrocortisone hidrocortisona 17-hydroxycorticosterone Hydrocortisone 11beta,17,21-trihydroxypregn-4-ene-3,20-dione Cortisol cortisol |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5980 Wikipedia:Hydrocortisone KEGG:D00088 Patent:US2602769 Beilstein:1354819 Drug_Central:1388 PDBeChem:HCY KEGG:C00735 CAS:50-23-7 PMID:2268561 PMID:10438974 DrugBank:DB00741 LIPID_MAPS_instance:LMST02030001 |
|
definition |
A 17alpha-hydroxy-C21-steroid that is pregn-4-ene substituted by oxo groups at positions 3 and 20 and hydroxy groups at positions 11, 17 and 21. Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the "stress hormone" as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses. |
|
formula |
C21H30O5 |
|
has exact synonym |
11beta,17,21-trihydroxypregn-4-ene-3,20-dione Cortisol cortisol |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_35472 http://purl.obolibrary.org/obo/CHEBI_88188 |
|
has_alternative_id |
CHEBI:58221 CHEBI:24633 CHEBI:14023 CHEBI:3893 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Kendall's compound F Reichstein's substance M hydrocortisonum 11beta,17alpha,21-trihydroxy-4-pregnene-3,20-dione (11beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione 4-pregnen-11beta,17alpha,21-triol-3,20-dione hydrocortisone 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione 11beta-hydrocortisone hidrocortisona 17-hydroxycorticosterone Hydrocortisone |
|
has_RxCUI |
5492 |
|
id |
CHEBI:17650 |
|
in_subset | ||
inchi |
InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
|
inchikey |
JYGXADMDTFJGBT-VWUMJDOOSA-N |
|
is_bearer_of | ||
label |
cortisol |
|
mass |
362.45990 |
|
monoisotopicmass |
362.20932 |
|
notation |
CHEBI:17650 |
|
prefLabel |
cortisol |
|
smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139590 http://purl.obolibrary.org/obo/CHEBI_139592 http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_138141 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_35344 |