loading...| Preferred Name | adenosine | |
| Synonyms |
9-beta-D-Ribofuranosidoadenine Deoxyadenosine Adenine Deoxyribonucleoside 9-beta-D-ribofuranosyl-9H-purin-6-amine Desoxyadenosine 6-Amino-9-beta-D-ribofuranosyl-9H-purine Adenyldeoxyriboside beta-D-Adenosine (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol 9-beta-D-Ribofuranosyl-9H-purin-6-amine Ade-Rib Adenocard Adenocor Adenoscan Adenosin Ado ADENOSINE Adenosine adenosine |
|
| Definitions |
A ribonucleoside composed of a molecule of adenine attached to a ribofuranose moiety via a beta-N(9)-glycosidic bond. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16335 |
|
| alternative_term |
ADENOSINE Adenosine adenosine |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18000974 Reaxys:93029 Drug_Central:90 PMID:11820865 DrugBank:DB00640 KEGG:D00045 MetaCyc:ADENOSINE PMID:16183671 PMID:323854 PMID:11213237 PMID:11978011 Gmelin:53385 LINCS:LSM-28568 YMDB:YMDB00058 PMID:17190852 CAS:58-61-7 ECMDB:ECMDB00050 Wikipedia:Adenosine KEGG:C00212 KNApSAcK:C00007444 PMID:16917093 Beilstein:93029 HMDB:HMDB0000050 PDBeChem:ADN |
|
| definition |
A ribonucleoside composed of a molecule of adenine attached to a ribofuranose moiety via a beta-N(9)-glycosidic bond. |
|
| DrugsinVirtualScreening |
true |
|
| formula |
C10H13N5O4 |
|
| fromArticle |
true |
|
| has_alternative_id |
CHEBI:40906 CHEBI:40825 CHEBI:22237 CHEBI:13734 CHEBI:40558 CHEBI:2472 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
9-beta-D-Ribofuranosidoadenine Deoxyadenosine Adenine Deoxyribonucleoside 9-beta-D-ribofuranosyl-9H-purin-6-amine Desoxyadenosine 6-Amino-9-beta-D-ribofuranosyl-9H-purine Adenyldeoxyriboside beta-D-Adenosine (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol 9-beta-D-Ribofuranosyl-9H-purin-6-amine Ade-Rib Adenocard Adenocor Adenoscan Adenosin Ado |
|
| id |
CHEBI:16335 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
|
| inchikey |
OIRDTQYFTABQOQ-KQYNXXCUSA-N |
|
| label |
adenosine |
|
| mass |
267.24152 |
|
| monoisotopicmass |
267.09675 |
|
| notation |
CHEBI:16335 |
|
| preferred label |
adenosine |
|
| prefLabel |
adenosine |
|
| see also | ||
| smiles |
Nc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
|
| textual definition |
A ribonucleoside composed of a molecule of adenine attached to a ribofuranose moiety via a beta-N(9)-glycosidic bond. |
|
| subClassOf |