Preferred Name |
propionic acid |
|
Synonyms |
PROPANOIC ACID acide propionique ethanecarboxylic acid propoic acid propioic acid Propanoic acid ethylformic acid metacetonic acid carboxyethane Propionsaeure methylacetic acid acide propanoique pseudoacetic acid CH3-CH2-COOH PA Propionic acid propanoic acid propionic acid |
|
Definitions |
A short-chain saturated fatty acid comprising ethane attached to the carbon of a carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30768 |
|
alternative term |
PROPANOIC ACID acide propionique ethanecarboxylic acid propoic acid propioic acid Propanoic acid ethylformic acid metacetonic acid carboxyethane Propionsaeure methylacetic acid acide propanoique pseudoacetic acid CH3-CH2-COOH PA Propionic acid propanoic acid propionic acid |
|
charge |
0 |
|
database_cross_reference |
CAS:79-09-4 DrugBank:DB03766 KEGG:C00163 PMID:15868474 PDBeChem:PPI Gmelin:1821 KEGG:D02310 Beilstein:506071 LIPID_MAPS_instance:LMFA01010003 PMID:16763906 PMID:1628870 PPDB:1341 |
|
formula |
C3H6O2 |
|
has exact synonym |
Propionic acid propanoic acid propionic acid |
|
has role | ||
has_alternative_id |
CHEBI:45227 CHEBI:26304 CHEBI:8476 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
PROPANOIC ACID acide propionique ethanecarboxylic acid propoic acid propioic acid Propanoic acid ethylformic acid metacetonic acid carboxyethane Propionsaeure methylacetic acid acide propanoique pseudoacetic acid CH3-CH2-COOH PA |
|
id |
CHEBI:30768 |
|
imported from | ||
in subset | ||
inchi |
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
|
inchikey |
XBDQKXXYIPTUBI-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
propionic acid |
|
mass |
74.07850 |
|
monoisotopicmass |
74.03678 |
|
notation |
CHEBI:30768 |
|
prefLabel |
propionic acid |
|
smiles |
CCC(O)=O |
|
textual definition |
A short-chain saturated fatty acid comprising ethane attached to the carbon of a carboxy group. |
|
subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.