Preferred Name |
benzoic acid |
|
Synonyms |
Aromatic carboxylic acid Benzoesaeure Benzenecarboxylic acid Phenylcarboxylic acid Benzeneformic acid Benzenemethanoic acid acide benzoique Dracylic acid Phenylformic acid E210 benzoic acid BENZOIC ACID Benzoic acid |
|
Definitions |
A compound comprising a benzene ring core carrying a carboxylic acid substituent. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30746 |
|
alternative term |
Aromatic carboxylic acid Benzoesaeure Benzenecarboxylic acid Phenylcarboxylic acid Benzeneformic acid Benzenemethanoic acid acide benzoique Dracylic acid Phenylformic acid E210 benzoic acid BENZOIC ACID Benzoic acid |
|
charge |
0 |
|
database_cross_reference |
MetaCyc:BENZOATE KEGG:C00180 KNApSAcK:C00000207 Reaxys:636131 PMID:18314336 PDBeChem:BEZ PMID:17439666 PMID:16728954 Drug_Central:4664 KEGG:C00539 KEGG:D00038 LINCS:LSM-37118 Beilstein:636131 YMDB:YMDB02301 Wikipedia:Benzoic_Acid HMDB:HMDB0001870 DrugBank:DB03793 Gmelin:2946 CAS:65-85-0 PPDB:1475 |
|
formula |
C7H6O2 |
|
has exact synonym |
benzoic acid BENZOIC ACID Benzoic acid |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_64996 http://purl.obolibrary.org/obo/CHEBI_65001 http://purl.obolibrary.org/obo/CHEBI_88188 http://purl.obolibrary.org/obo/CHEBI_76967 |
|
has_alternative_id |
CHEBI:41051 CHEBI:22722 CHEBI:3029 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Aromatic carboxylic acid Benzoesaeure Benzenecarboxylic acid Phenylcarboxylic acid Benzeneformic acid Benzenemethanoic acid acide benzoique Dracylic acid Phenylformic acid E210 |
|
id |
CHEBI:30746 |
|
imported from | ||
in subset | ||
inchi |
InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
|
inchikey |
WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
benzoic acid |
|
mass |
122.12130 |
|
monoisotopicmass |
122.03678 |
|
notation |
CHEBI:30746 |
|
prefLabel |
benzoic acid |
|
smiles |
OC(=O)c1ccccc1 |
|
textual definition |
A compound comprising a benzene ring core carrying a carboxylic acid substituent. |
|
subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.