loading...| Preferred Name |
tryptophan |
|
| Synonyms |
Tryptophan tryptophan 2-amino-3-(1H-indol-3-yl)propanoic acid alpha-amino-beta-3-indolepropionic acid beta-3-indolylalanine alpha-Amino-beta-(3-indolyl)-propionic acid tryptophane Htrp Trp W triptofano |
|
| Definitions |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27897 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Tryptophan Gmelin:4532 Reaxys:86196 PMID:17439666 PMID:22264337 CAS:54-12-6 Beilstein:86196 KEGG:C00806 KNApSAcK:C00001396 LINCS:LSM-36836 |
|
| formula |
C11H12N2O2 |
|
| has exact synonym |
Tryptophan tryptophan |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:27163 CHEBI:9769 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-amino-3-(1H-indol-3-yl)propanoic acid alpha-amino-beta-3-indolepropionic acid beta-3-indolylalanine alpha-Amino-beta-(3-indolyl)-propionic acid tryptophane Htrp Trp W triptofano |
|
| id |
CHEBI:27897 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
|
| inchikey |
QIVBCDIJIAJPQS-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
tryptophan |
|
| mass |
204.22526 |
|
| monoisotopicmass |
204.08988 |
|
| notation |
CHEBI:27897 |
|
| prefLabel |
tryptophan |
|
| smiles |
NC(Cc1c[nH]c2ccccc12)C(O)=O |
|
| textual definition |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33856 http://purl.obolibrary.org/obo/CHEBI_33704 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.