loading...| Preferred Name |
methionine |
|
| Synonyms |
Methionine methionine Racemethionine DL-Methionine 2-amino-4-(methylthio)butanoic acid 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid 2-amino-4-(methylsulfanyl)butanoic acid Hmet M Met Methionin metionina |
|
| Definitions |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:59-51-8 KEGG:C01733 PMID:16702333 PMID:22264337 PMID:2543976 Wikipedia:Methionine UM-BBD_compID:c0094 Beilstein:636185 Reaxys:636185 KEGG:D04983 Gmelin:3117 |
|
| formula |
C5H11NO2S |
|
| has exact synonym |
Methionine methionine |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_75772 |
|
| has_alternative_id |
CHEBI:25229 CHEBI:14590 CHEBI:6829 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Racemethionine DL-Methionine 2-amino-4-(methylthio)butanoic acid 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid 2-amino-4-(methylsulfanyl)butanoic acid Hmet M Met Methionin metionina |
|
| id |
CHEBI:16811 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
|
| inchikey |
FFEARJCKVFRZRR-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
methionine |
|
| mass |
149.21238 |
|
| monoisotopicmass |
149.05105 |
|
| notation |
CHEBI:16811 |
|
| prefLabel |
methionine |
|
| smiles |
CSCCC(N)C(O)=O |
|
| textual definition |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.