Preferred Name |
folic acid |
|
Synonyms |
pteroylmonoglutamic acid PGA vitamin Be folic acid vitamin Bc acidum folicum Folicet Folate Folsaeure N-pteroyl-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid (2S)-2-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzamido)pentanedioic acid vitamin M acide folique pteroyl-L-glutamic acid acido folico Acfol pteroyl-L-monoglutamic acid vitamin B11 PteGlu pteroylglutamic acid vitamin B9 N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
|
Definitions |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27470 |
|
charge |
0 |
|
database_cross_reference |
PMID:15797685 PMID:9808641 PMID:16093404 PMID:9565830 PMID:16380297 KEGG:C00504 PMID:19335717 PMID:16277678 PMID:9420019 PMID:33968971 PMID:7738698 FooDB:FDB014504 Wikipedia:Folic_Acid PMID:11451208 PMID:16871332 PMID:17784727 KNApSAcK:C00001539 PMID:15797531 PMID:9040515 PMID:9683174 HMDB:HMDB0000121 PMID:9781393 PMID:9808640 LINCS:LSM-5355 PMID:10958818 CAS:59-30-3 Drug_Central:1231 PMID:24650098 PMID:10897644 PMID:8235383 PMID:34207319 PMID:11261364 PMID:14387833 PDBeChem:FOL PMID:15990733 PMID:10138938 PMID:18788725 PMID:19355913 KEGG:D00070 DrugBank:DB00158 PMID:11959400 PMID:34219855 PMID:15754725 PMID:15321809 PMID:15831910 Reaxys:100781 AGR:IND606960789 MetaCyc:CPD-12826 PMID:19121630 PMID:15523939 PMID:33624660 PMID:33965562 Chemspider:5815 Beilstein:100781 |
|
definition |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
|
formula |
C19H19N7O6 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_33284 |
|
has_alternative_id |
CHEBI:5140 CHEBI:569217 CHEBI:24075 CHEBI:42610 |
|
has_exact_synonym |
N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
pteroylmonoglutamic acid PGA vitamin Be folic acid vitamin Bc acidum folicum Folicet Folate Folsaeure N-pteroyl-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid (2S)-2-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzamido)pentanedioic acid vitamin M acide folique pteroyl-L-glutamic acid acido folico Acfol pteroyl-L-monoglutamic acid vitamin B11 PteGlu pteroylglutamic acid vitamin B9 |
|
id |
CHEBI:27470 |
|
in_subset | ||
inchi |
InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 |
|
inchikey |
OVBPIULPVIDEAO-LBPRGKRZSA-N |
|
is conjugate acid of | ||
label |
folic acid |
|
mass |
441.39750 |
|
monoisotopicmass |
441.13968 |
|
notation |
CHEBI:27470 |
|
prefLabel |
folic acid |
|
smiles |
Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1 |
|
treeView | ||
subClassOf |