Preferred Name |
busulfan |
|
Synonyms |
busulfan Mablin busulfanum Mitostan busulfano Tetramethylene bis(methanesulfonate) Leucosulfan Misulban 1,4-Bis(methanesulfonoxy)butane Myleran 1,4-Dimethanesulfonoxybutane 1,4-Dimesyloxybutane Mielucin 1,4-Butanediol dimethanesulfonate Bisulfex Myeloleukon butane-1,4-diyl dimethanesulfonate Busulfan |
|
Definitions |
A methanesulfonate ester that is butane-1,4-diol in which the hydrogens of the hydroxy groups are replaced by methanesulfonyl groups. An alkylating antineoplastic agent, it is used for the treatment of chronic myeloid leukemia (although it has been largely replaced by newer drugs). It is also used as an insect sterilant. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28901 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB01008 PMID:19361744 CAS:55-98-1 PMID:19611402 PMID:10523796 Patent:US2917432 KEGG:C06862 Drug_Central:438 LINCS:LSM-5388 Reaxys:1791786 Beilstein:1791786 KEGG:D00248 Wikipedia:Busulfan |
|
definition |
A methanesulfonate ester that is butane-1,4-diol in which the hydrogens of the hydroxy groups are replaced by methanesulfonyl groups. An alkylating antineoplastic agent, it is used for the treatment of chronic myeloid leukemia (although it has been largely replaced by newer drugs). It is also used as an insect sterilant. |
|
formula |
C6H14O6S2 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_50905 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_67105 |
|
has_alternative_id |
CHEBI:18936 CHEBI:3225 |
|
has_exact_synonym |
butane-1,4-diyl dimethanesulfonate Busulfan |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
busulfan Mablin busulfanum Mitostan busulfano Tetramethylene bis(methanesulfonate) Leucosulfan Misulban 1,4-Bis(methanesulfonoxy)butane Myleran 1,4-Dimethanesulfonoxybutane 1,4-Dimesyloxybutane Mielucin 1,4-Butanediol dimethanesulfonate Bisulfex Myeloleukon |
|
id |
CHEBI:28901 |
|
in_subset | ||
inchi |
InChI=1S/C6H14O6S2/c1-13(7,8)11-5-3-4-6-12-14(2,9)10/h3-6H2,1-2H3 |
|
inchikey |
COVZYZSDYWQREU-UHFFFAOYSA-N |
|
label |
busulfan |
|
mass |
246.30200 |
|
monoisotopicmass |
246.02318 |
|
notation |
CHEBI:28901 |
|
prefLabel |
busulfan |
|
smiles |
CS(=O)(=O)OCCCCOS(C)(=O)=O |
|
treeView | ||
subClassOf |