loading...| Preferred Name | thyroxine | |
| Synonyms |
O-(4-Hydroxy-3,5-diiodophenyl)-3,5-diiodo-DL-tyrosine 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid DL-Thyroxine Thx thyroxine |
|
| Definitions |
An iodothyronine compound having iodo substituents at the 3-, 3'-, 5- and 5'-positions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30660 |
|
| charge |
0 |
|
| database_cross_reference |
ChemIDplus:300-30-1 CiteXplore:15206581 SNOMEDCT:73187006 PMID:24375501 MeSH:D013974 PMID:15206581 CAS:300-30-1 PMID:9824273 Beilstein:2228514 NCIt:C2302 |
|
| definition |
An iodothyronine compound having iodo substituents at the 3-, 3'-, 5- and 5'-positions. |
|
| formula |
C15H11I4NO4 |
|
| has characteristic | ||
| has_exact_synonym |
thyroxine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
O-(4-Hydroxy-3,5-diiodophenyl)-3,5-diiodo-DL-tyrosine 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid DL-Thyroxine Thx |
|
| has_role | ||
| id |
CHEBI:30660 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23) |
|
| inchikey |
XUIIKFGFIJCVMT-UHFFFAOYSA-N |
|
| label |
thyroxine |
|
| mass |
776.87006 |
|
| monoisotopicmass |
776.68669 |
|
| notation |
CHEBI:30660 |
|
| preferred label |
thyroxine |
|
| prefLabel |
thyroxine |
|
| smiles |
NC(Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(O)=O |
|
| subClassOf |