loading...| Preferred Name | tyrosine | |
| Synonyms |
2-amino-3-(4-hydroxyphenyl)propanoic acid 2-Amino-3-(p-hydroxyphenyl)propionic acid 3-(p-Hydroxyphenyl)alanine Tyr Tyrosin Y tirosina Tyrosine tyrosine |
|
| Definitions |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18186 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:55520-40-6 KEGG:C01536 Beilstein:515881 Gmelin:27744 PMID:17190852 Reaxys:515881 CAS:556-03-6 KNApSAcK:C00001397 |
|
| definition |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
|
| formula |
C9H11NO3 |
|
| has_alternative_id |
CHEBI:15277 CHEBI:27176 CHEBI:9800 |
|
| has_exact_synonym |
Tyrosine tyrosine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-amino-3-(4-hydroxyphenyl)propanoic acid 2-Amino-3-(p-hydroxyphenyl)propionic acid 3-(p-Hydroxyphenyl)alanine Tyr Tyrosin Y tirosina |
|
| id |
CHEBI:18186 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
|
| inchikey |
OUYCCCASQSFEME-UHFFFAOYSA-N |
|
| label |
tyrosine |
|
| mass |
181.18858 |
|
| monoisotopicmass |
181.07389 |
|
| notation |
CHEBI:18186 |
|
| OBI_0000316 |
http://livercancer.imbi.uni-heidelberg.de/ccont#CCONT_0000004 |
|
| preferred label |
tyrosine |
|
| prefixIRI |
CHEBI:18186 |
|
| prefLabel |
tyrosine |
|
| smiles |
NC(Cc1ccc(O)cc1)C(O)=O |
|
| subClassOf |