Jump to:
loading...| Preferred Name |
glutamate(2-) |
|
| Synonyms |
|
|
| Definitions |
An alpha-amino-acid anion that has formula C5H7NO4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29987 |
|
| alternative term |
2-aminopentanedioate NC(CCC([O-])=O)C([O-])=O InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-2 InChIKey=WHUUTDBJXJRKMK-UHFFFAOYSA-L C5H7NO4 glutamate(2-) glutamate glutamic acid dianion |
|
| definition |
An alpha-amino-acid anion that has formula C5H7NO4. |
|
| is conjugate base of | ||
| label |
glutamate(2-) |
|
| prefixIRI |
CHEBI:29987 |
|
| prefLabel |
glutamate(2-) |
|
| subClassOf |
Create mapping