Jump to:
loading...| Preferred Name | chlorambucil | |
| Synonyms |
|
|
| Definitions |
A nitrogen mustard that has formula C14H19Cl2NO2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28830 |
|
| alternative term |
Ambochlorin phenylbutyric acid nitrogen mustard InChI=1S/C14H19Cl2NO2/c15-8-10-17(11-9-16)13-6-4-12(5-7-13)2-1-3-14(18)19/h4-7H,1-3,8-11H2,(H,18,19) 4-(p-bis(beta-chloroethyl)aminophenyl)butyric acid Leukeran 4-{4-[bis(2-chloroethyl)amino]phenyl}butanoic acid 4-[p-[bis(2-chloroethyl)amino]phenyl]butyric acid OC(=O)CCCc1ccc(cc1)N(CCCl)CCCl N,N-di-2-chloroethyl-gamma-p-aminophenylbutyric acid Chlorambucil InChIKey=JCKYGMPEJWAADB-UHFFFAOYSA-N C14H19Cl2NO2 CHLORAMBUCIL chloraminophen gamma-[p-di(2-chloroethyl)aminophenyl]butyric acid |
|
| definition |
A nitrogen mustard that has formula C14H19Cl2NO2. |
|
| has role | ||
| label |
chlorambucil |
|
| prefixIRI |
CHEBI:28830 |
|
| prefLabel |
chlorambucil |
|
| subClassOf |
Create mapping