Preferred Name | amphetamine | |
Synonyms |
|
|
Definitions |
A member of the amphetamines that has formula C9H13N. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2679 |
|
alternative term |
C9H13N Amphetamine 1-phenylpropan-2-amine InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 beta-aminopropylbenzene Amphetamin desoxynorephedrine beta-phenylisopropylamine alpha-methylphenylethylamine Amfetamine CC(N)Cc1ccccc1 beta-Phenylisopropylamin alpha-methylbenzeneethaneamine amfetaminum 1-phenyl-2-aminopropane 1-Phenylpropan-2-amin InChIKey=KWTSXDURSIMDCE-UHFFFAOYSA-N amphetamine |
|
definition |
A member of the amphetamines that has formula C9H13N. |
|
label |
amphetamine |
|
prefixIRI |
CHEBI:2679 |
|
prefLabel |
amphetamine |
|
subClassOf |
Create mapping