loading...| Preferred Name | cortisol | |
| Synonyms |
|
|
| Definitions |
Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the "stress hormone" as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17650 |
|
| alternative term |
Cortisol 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione Reichstein's substance M Hydrocortisone Kendall's compound F hydrocortisone hidrocortisona hydrocortisonum InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 4-pregnen-11beta,17alpha,21-triol-3,20-dione (11beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione cortisol [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO C21H30O5 11beta,17alpha,21-trihydroxy-4-pregnene-3,20-dione 11beta-hydrocortisone 17-hydroxycorticosterone InChIKey=JYGXADMDTFJGBT-VWUMJDOOSA-N 11beta,17,21-trihydroxypregn-4-ene-3,20-dione |
|
| definition |
Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the "stress hormone" as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35472 |
|
| label |
cortisol |
|
| prefixIRI |
CHEBI:17650 |
|
| prefLabel |
cortisol |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_47788 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_35344 http://purl.obolibrary.org/obo/CHEBI_35342 |