Jump to:
loading...| Preferred Name | benzoate | |
| Synonyms |
|
|
| Definitions |
The conjugate base of benzoic acid, comprising a benzoic acid core with a proton missing to give a charge of -1. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16150 |
|
| alternative term |
benzoate benzoate anion benzoic acid, ion(1-) C7H5O2 [O-]C(=O)c1ccccc1 InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M |
|
| definition |
The conjugate base of benzoic acid, comprising a benzoic acid core with a proton missing to give a charge of -1. |
|
| is conjugate base of | ||
| label |
benzoate |
|
| prefixIRI |
CHEBI:16150 |
|
| prefLabel |
benzoate |
|
| subClassOf |
Create mapping