Jump to:
loading...| Preferred Name | pyruvate | |
| Synonyms |
|
|
| Definitions |
A 2-oxo monocarboxylic acid anion that has formula C3H3O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15361 |
|
| alternative term |
C3H3O3 2-oxopropanoic acid, ion(1-) 2-oxopropanoate InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 CC(=O)C([O-])=O InChIKey=LCTONWCANYUPML-UHFFFAOYSA-M |
|
| definition |
A 2-oxo monocarboxylic acid anion that has formula C3H3O3. |
|
| has functional parent | ||
| is conjugate base of | ||
| label |
pyruvate |
|
| prefixIRI |
CHEBI:15361 |
|
| prefLabel |
pyruvate |
|
| subClassOf |
Create mapping