loading...| Preferred Name | octadec-9-enoic acid | |
| Synonyms |
Delta(9)-octadecenoic acid 9-octadecenoic acid 18:1, n-9 C18:1, n-9 octadec-9-enoic acid |
|
| Definitions |
An octadecenoic acid with a double bond at C-9. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36021 |
|
| alternative term |
Delta(9)-octadecenoic acid 9-octadecenoic acid 18:1, n-9 C18:1, n-9 octadec-9-enoic acid |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:23578483 CAS:2027-47-6 Beilstein:1726541 PMID:22908585 Reaxys:1726541 PMID:20110887 PMID:24478215 |
|
| definition |
An octadecenoic acid with a double bond at C-9. |
|
| formula |
C18H34O2 |
|
| has_exact_synonym |
octadec-9-enoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_parent_hydride | ||
| has_related_synonym |
Delta(9)-octadecenoic acid 9-octadecenoic acid 18:1, n-9 C18:1, n-9 |
|
| id |
CHEBI:36021 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20) |
|
| inchikey |
ZQPPMHVWECSIRJ-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
octadec-9-enoic acid |
|
| mass |
282.46136 |
|
| monoisotopicmass |
282.25588 |
|
| notation |
CHEBI:36021 |
|
| prefLabel |
octadec-9-enoic acid |
|
| RO_0000087 | ||
| smiles |
[H]C(CCCCCCCC)=C([H])CCCCCCCC(O)=O |
|
| subClassOf |