Preferred Name |
alanine |
|
Synonyms |
2-Aminopropionic acid 2-Aminopropanoic acid A ALA Alanin alanina 2-aminopropanoic acid Alanine alanine |
|
Definitions |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
|
alternative term |
2-Aminopropionic acid 2-Aminopropanoic acid A ALA Alanin alanina 2-aminopropanoic acid Alanine alanine |
|
bearer of | ||
charge |
0 |
|
database_cross_reference |
CAS:302-72-7 Gmelin:2449 Beilstein:635807 PMID:17439666 PMID:22264337 KEGG:C01401 Drug_Central:4306 Wikipedia:Alanine Reaxys:635807 |
|
definition |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
formula |
C3H7NO2 |
|
has_alternative_id |
CHEBI:13748 CHEBI:22277 CHEBI:2539 |
|
has_exact_synonym |
2-aminopropanoic acid Alanine alanine |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Aminopropionic acid 2-Aminopropanoic acid A ALA Alanin alanina |
|
id |
CHEBI:16449 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
|
inchikey |
QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
is_tautomer_of | ||
label |
alanine |
|
mass |
89.09322 |
|
monoisotopicmass |
89.04768 |
|
notation |
CHEBI:16449 |
|
prefLabel |
alanine |
|
RO_0000087 | ||
smiles |
CC(N)C(O)=O |
|
subClassOf |