Preferred Name |
2-amino-3-methylpentanoic acid |
|
Synonyms |
2-amino-3-methylpentanoic acid |
|
Definitions |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_38264 |
|
charge |
0 |
|
database_cross_reference |
CAS:443-79-8 PMID:10944265 KEGG:C16434 Reaxys:1721790 |
|
definition |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
|
formula |
C6H13NO2 |
|
has exact synonym |
2-amino-3-methylpentanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:38264 |
|
in_subset | ||
inchi |
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
|
inchikey |
AGPKZVBTJJNPAG-UHFFFAOYSA-N |
|
label |
2-amino-3-methylpentanoic acid |
|
mass |
131.17296 |
|
monoisotopicmass |
131.09463 |
|
notation |
CHEBI:38264 |
|
prefLabel |
2-amino-3-methylpentanoic acid |
|
smiles |
CCC(C)C(N)C(O)=O |
|
subClassOf |
Create mapping