loading...| Preferred Name |
gamma-aminobutyrate |
|
| Synonyms |
4-aminobutyrate 4-aminobutanoic acid ion (1-) 4-Aminobutylate gamma-aminobutyrate anion gamma-aminobutanoate 4-Amino-butyrat 4-aminobutanoate |
|
| Definitions |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30566 |
|
| charge |
-1 |
|
| database_cross_reference |
KEGG:C00334 Gmelin:559138 Beilstein:3536873 Reaxys:3536873 PMID:12509893 |
|
| definition |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
|
| formula |
C4H8NO2 |
|
| has characteristic | ||
| has exact synonym |
4-aminobutanoate |
|
| has functional parent | ||
| has related synonym |
4-aminobutyrate 4-aminobutanoic acid ion (1-) 4-Aminobutylate gamma-aminobutyrate anion gamma-aminobutanoate 4-Amino-butyrat |
|
| has role | ||
| has_alternative_id |
CHEBI:20317 CHEBI:11961 |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:30566 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/p-1 |
|
| inchikey |
BTCSSZJGUNDROE-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
gamma-aminobutyrate |
|
| mass |
102.11186 |
|
| monoisotopicmass |
102.05605 |
|
| notation |
CHEBI:30566 |
|
| prefLabel |
gamma-aminobutyrate |
|
| smiles |
NCCCC([O-])=O |
|
| subClassOf |