loading...| Preferred Name |
icosanoic acid |
|
| Synonyms |
icosanoic acid arachidinic acid eicosanoic acid arachic acid Arachinsaeure Arachidic acid arachidic acid n-eicosanoic acid CH3-[CH2]18-COOH C20:0 |
|
| Definitions |
A C20 striaght-chain saturated fatty acid which forms a minor constituent of peanut (L. arachis) and corn oils. Used as an organic thin film in the production of liquid crystals for a wide variety of technical applications. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28822 |
|
| charge |
0 |
|
| database_cross_reference |
PDBeChem:DCR MetaCyc:ARACHIDIC_ACID LIPID_MAPS_instance:LMFA01010020 CAS:506-30-9 Wikipedia:Arachidic_acid KNApSAcK:C00001209 PMID:18036601 HMDB:HMDB0002212 KEGG:C06425 Patent:WO2013000382 PMID:17279692 PMID:19908738 Gmelin:854866 Reaxys:1788211 Patent:CN102352348 Beilstein:1788211 |
|
| definition |
A C20 striaght-chain saturated fatty acid which forms a minor constituent of peanut (L. arachis) and corn oils. Used as an organic thin film in the production of liquid crystals for a wide variety of technical applications. |
|
| formula |
C20H40O2 |
|
| has exact synonym |
icosanoic acid |
|
| has related synonym |
arachidinic acid eicosanoic acid arachic acid Arachinsaeure Arachidic acid arachidic acid n-eicosanoic acid CH3-[CH2]18-COOH C20:0 |
|
| has role | ||
| has_alternative_id |
CHEBI:24763 CHEBI:2798 |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:28822 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22) |
|
| inchikey |
VKOBVWXKNCXXDE-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
icosanoic acid |
|
| mass |
312.53040 |
|
| monoisotopicmass |
312.30283 |
|
| notation |
CHEBI:28822 |
|
| prefLabel |
icosanoic acid |
|
| smiles |
CCCCCCCCCCCCCCCCCCCC(O)=O |
|
| subClassOf |