loading...| Preferred Name |
octanoate |
|
| Synonyms |
n-octanoate 1-heptanecarboxylate n-caprylate octanoic acid, ion(1-) CH3-[CH2]6-COO(-) caprilate caprylate n-octoate n-octylate octylate octanoate |
|
| Definitions |
A straight-chain saturated fatty acid anion that is the conjugate base of octanoic acid (caprylic acid); believed to block adipogenesis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25646 |
|
| charge |
-1 |
|
| database_cross_reference |
Reaxys:3588079 PMID:11983812 Gmelin:329219 CAS:74-81-7 UM-BBD_compID:c0047 Beilstein:3588079 |
|
| definition |
A straight-chain saturated fatty acid anion that is the conjugate base of octanoic acid (caprylic acid); believed to block adipogenesis. |
|
| formula |
C8H15O2 |
|
| has characteristic | ||
| has exact synonym |
octanoate |
|
| has related synonym |
n-octanoate 1-heptanecarboxylate n-caprylate octanoic acid, ion(1-) CH3-[CH2]6-COO(-) caprilate caprylate n-octoate n-octylate octylate |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:25646 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/p-1 |
|
| inchikey |
WWZKQHOCKIZLMA-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
octanoate |
|
| mass |
143.204 |
|
| monoisotopicmass |
143.10775 |
|
| notation |
CHEBI:25646 |
|
| prefLabel |
octanoate |
|
| smiles |
C(CCCCCC)C(=O)[O-] |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_58954 |