loading...| Preferred Name |
L-threonine |
|
| Synonyms |
L-Threonine L-threonine (2S,3R)-2-amino-3-hydroxybutanoic acid L-alpha-amino-beta-hydroxybutyric acid (2S,3R)-(-)-Threonine 2-Amino-3-hydroxybutyric acid L-(-)-Threonine L-2-Amino-3-hydroxybutyric acid (2S)-threonine L-Threonin T THREONINE Thr |
|
| Definitions |
An optically active form of threonine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16857 |
|
| charge |
0 |
|
| database_cross_reference |
YMDB:YMDB00214 Beilstein:1721646 PMID:24671569 Drug_Central:4254 HMDB:HMDB0000167 KEGG:C00188 DrugBank:DB00156 Wikipedia:Threonine Gmelin:82510 KEGG:D00041 UM-BBD_compID:c0413 PMID:17379183 PDBeChem:THR PMID:22289691 PMID:12523390 PMID:11964235 PMID:16659349 PMID:22513921 KNApSAcK:C00001394 PMID:22342587 PMID:22770225 ECMDB:ECMDB00167 CAS:72-19-5 Reaxys:1721646 |
|
| definition |
An optically active form of threonine having L-configuration. |
|
| formula |
C4H9NO3 |
|
| has exact synonym |
L-Threonine L-threonine |
|
| has related synonym |
(2S,3R)-2-amino-3-hydroxybutanoic acid L-alpha-amino-beta-hydroxybutyric acid (2S,3R)-(-)-Threonine 2-Amino-3-hydroxybutyric acid L-(-)-Threonine L-2-Amino-3-hydroxybutyric acid (2S)-threonine L-Threonin T THREONINE Thr |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 |
|
| has_alternative_id |
CHEBI:45843 CHEBI:42083 CHEBI:45983 CHEBI:21403 CHEBI:13175 CHEBI:6308 |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:16857 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 |
|
| inchikey |
AYFVYJQAPQTCCC-GBXIJSLDSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-threonine |
|
| mass |
119.11920 |
|
| monoisotopicmass |
119.05824 |
|
| notation |
CHEBI:16857 |
|
| prefLabel |
L-threonine |
|
| smiles |
C[C@@H](O)[C@H](N)C(O)=O |
|
| subClassOf |