loading...| Preferred Name |
androst-4-ene-3,17-dione |
|
| Synonyms |
Androst-4-ene-3,17-dione androst-4-ene-3,17-dione Delta(4)-androstene-3,17-dione 4-Androstene-3,17-dione Delta(4)-androsten-3,17-dione Androstenedione 4-ANDROSTENE-3-17-DIONE |
|
| Definitions |
A 3-oxo Delta(4)-steroid that is androst-4-ene substituted by oxo groups at positions 3 and 17. It is a steroid hormone synthesized in the adrenal glands and gonads. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16422 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00051 LIPID_MAPS_instance:LMST02020007 PMID:24423344 Drug_Central:215 DrugBank:DB01536 Beilstein:2059239 KNApSAcK:C00003644 PMID:24740546 PDBeChem:ASD CAS:63-05-8 Reaxys:2059239 Gmelin:961672 HMDB:HMDB0000053 KEGG:C00280 Wikipedia:Androstenedione MetaCyc:ANDROST4ENE |
|
| definition |
A 3-oxo Delta(4)-steroid that is androst-4-ene substituted by oxo groups at positions 3 and 17. It is a steroid hormone synthesized in the adrenal glands and gonads. |
|
| formula |
C19H26O2 |
|
| has exact synonym |
Androst-4-ene-3,17-dione androst-4-ene-3,17-dione |
|
| has related synonym |
Delta(4)-androstene-3,17-dione 4-Androstene-3,17-dione Delta(4)-androsten-3,17-dione Androstenedione 4-ANDROSTENE-3-17-DIONE |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:20322 CHEBI:13830 CHEBI:40930 CHEBI:11964 CHEBI:2709 |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:16422 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
|
| inchikey |
AEMFNILZOJDQLW-QAGGRKNESA-N |
|
| label |
androst-4-ene-3,17-dione |
|
| mass |
286.40850 |
|
| monoisotopicmass |
286.19328 |
|
| notation |
CHEBI:16422 |
|
| prefLabel |
androst-4-ene-3,17-dione |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50402 http://purl.obolibrary.org/obo/BFO_0000004 |