Preferred Name |
pyruvate |
|
Synonyms |
2-oxopropanoate pyruvate 2-oxopropanoic acid, ion(1-) |
|
Definitions |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15361 |
|
charge |
-1 |
|
database_cross_reference |
UM-BBD_compID:c0159 PMID:21603897 Reaxys:3587721 PMID:22006570 CAS:57-60-3 PMID:21854850 PMID:22451307 Gmelin:2502 Beilstein:3587721 PMID:21823181 PMID:17190852 PMID:22215378 PMID:22311625 PMID:22016370 PMID:22458763 KEGG:C00022 |
|
definition |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
formula |
C3H3O3 |
|
has exact synonym |
2-oxopropanoate pyruvate |
|
has functional parent | ||
has related synonym |
2-oxopropanoic acid, ion(1-) 2-oxopropanoate |
|
has role | ||
has_alternative_id |
CHEBI:14987 CHEBI:26462 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:15361 |
|
in_subset | ||
inchi |
InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 |
|
inchikey |
LCTONWCANYUPML-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
pyruvate |
|
mass |
87.05412 |
|
monoisotopicmass |
87.00877 |
|
notation |
CHEBI:15361 |
|
prefLabel |
pyruvate |
|
smiles |
CC(=O)C([O-])=O |
|
subClassOf |