Preferred Name |
atazanavir |
|
Synonyms |
dimethyl (3S,8S,9S,12S)-9-benzyl-3,12-di-tert-butyl-8-hydroxy-4,11-dioxo-6-[4-(2-pyridyl)benzyl]-2,5,6,10,13-pentaazatetradecanedioate |
|
Definitions |
A heavily substituted carbohydrazide that is an antiretroviral drug of the protease inhibitor (PI) class used to treat infection of human immunodeficiency virus (HIV). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_37924 |
|
database_cross_reference |
DrugBank:DB01072 Wikipedia:Atazanavir CAS:198904-31-3 |
|
definition |
A heavily substituted carbohydrazide that is an antiretroviral drug of the protease inhibitor (PI) class used to treat infection of human immunodeficiency virus (HIV). |
|
has role | ||
has_exact_synonym |
dimethyl (3S,8S,9S,12S)-9-benzyl-3,12-di-tert-butyl-8-hydroxy-4,11-dioxo-6-[4-(2-pyridyl)benzyl]-2,5,6,10,13-pentaazatetradecanedioate |
|
label |
atazanavir |
|
prefixIRI |
CHEBI:37924 |
|
prefLabel |
atazanavir |
|
smiles |
COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc1ccc(cc1)-c1ccccn1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C |
|
subClassOf |