Jump to:
loading...| Preferred Name |
L-gamma-glutamyl-L-cysteinylglycine |
|
| Synonyms |
Glutathione 5-L-Glutamyl-L-cysteinylglycine Reduced glutathione GSH |
|
| Definitions |
A tripeptide compound consisting of glutamic acid attached via its side chain to the N-terminus of cysteinylglycine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16856 |
|
| database_cross_reference |
Wikipedia:Glutathione DrugBank:DB00143 |
|
| definition |
A tripeptide compound consisting of glutamic acid attached via its side chain to the N-terminus of cysteinylglycine. |
|
| formula |
C10H17N3O6S |
|
| has_exact_synonym |
Glutathione |
|
| has_related_synonym |
5-L-Glutamyl-L-cysteinylglycine Reduced glutathione GSH |
|
| label |
L-gamma-glutamyl-L-cysteinylglycine |
|
| prefixIRI |
CHEBI:16856 |
|
| prefLabel |
L-gamma-glutamyl-L-cysteinylglycine |
|
| smiles |
N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
|
| subClassOf |
Create mapping